C31H43NO4 — CID 145281556
4,6a,8a,11,11,14b-hexamethyl-3,13-dioxo-4,4a,5,6,6a,6b,7,8,9,10,12,12a-dodecahydropicene-2-carbonitrile;methyl formate (PubChem CID 145281556) has the molecular formula C31H43NO4 and a molecular weight of 493.69 g/mol. Its IUPAC name is 4,6a,8a,11,11,14b-hexamethyl-3,13-dioxo-4,4a,5,6,6a,6b,7,8,9,10,12,12a-dodecahydropicene-2-carbonitrile;methyl formate.
| Compound Name | 4,6a,8a,11,11,14b-hexamethyl-3,13-dioxo-4,4a,5,6,6a,6b,7,8,9,10,12,12a-dodecahydropicene-2-carbonitrile;methyl formate |
|---|---|
| PubChem CID | 145281556 |
| Molecular Formula | C31H43NO4 |
| Molecular Weight | 493.69 g/mol |
| Exact Mass | 493.32 |
| IUPAC Name | 4,6a,8a,11,11,14b-hexamethyl-3,13-dioxo-4,4a,5,6,6a,6b,7,8,9,10,12,12a-dodecahydropicene-2-carbonitrile;methyl formate |
| SMILES | CC1C(=O)C(C#N)=CC2(C)C3=CC(=O)C4C5CC(C)(C)CCC5(C)CCC4C3(C)CCC12.COC=O |
| InChI | InChI=1S/C29H39NO2.C2H4O2/c1-17-19-8-10-28(5)20-7-9-27(4)12-11-26(2,3)15-21(27)24(20)22(31)13-23(28)29(19,6)14-18(16-30)25(17)32;1-4-2-3/h13-14,17,19-21,24H,7-12,15H2,1-6H3;2H,1H3 |
| InChIKey | PXLVTNIZFKBUQD-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 84.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.69 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|