C31H39NO6 — CID 145281577
dimethyl 2-cyano-6a,11,11,14b-tetramethyl-3,13-dioxo-4,4a,5,6,6a,6b,7,8,9,10,12,12a-dodecahydropicene-4,8a-dicarboxylate (PubChem CID 145281577) has the molecular formula C31H39NO6 and a molecular weight of 521.65 g/mol. Its IUPAC name is dimethyl 2-cyano-6a,11,11,14b-tetramethyl-3,13-dioxo-4,4a,5,6,6a,6b,7,8,9,10,12,12a-dodecahydropicene-4,8a-dicarboxylate.
| Compound Name | dimethyl 2-cyano-6a,11,11,14b-tetramethyl-3,13-dioxo-4,4a,5,6,6a,6b,7,8,9,10,12,12a-dodecahydropicene-4,8a-dicarboxylate |
|---|---|
| PubChem CID | 145281577 |
| Molecular Formula | C31H39NO6 |
| Molecular Weight | 521.65 g/mol |
| Exact Mass | 521.28 |
| IUPAC Name | dimethyl 2-cyano-6a,11,11,14b-tetramethyl-3,13-dioxo-4,4a,5,6,6a,6b,7,8,9,10,12,12a-dodecahydropicene-4,8a-dicarboxylate |
| SMILES | COC(=O)C1C(=O)C(C#N)=CC2(C)C3=CC(=O)C4C(CCC5(C(=O)OC)CCC(C)(C)CC45)C3(C)CCC12 |
| InChI | InChI=1S/C31H39NO6/c1-28(2)11-12-31(27(36)38-6)10-8-18-23(20(31)15-28)21(33)13-22-29(18,3)9-7-19-24(26(35)37-5)25(34)17(16-32)14-30(19,22)4/h13-14,18-20,23-24H,7-12,15H2,1-6H3 |
| InChIKey | AIAOTFRWMWNBJN-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 110.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.65 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|