C22H18N2O4 — CID 24956183
3-(3,7-dicyano-1,1,4a-trimethyl-2,6-dioxo-10,10a-dihydro-9H-phenanthren-8a-yl)prop-2-ynoic acid (PubChem CID 24956183) has the molecular formula C22H18N2O4 and a molecular weight of 374.40 g/mol. Its IUPAC name is 3-(3,7-dicyano-1,1,4a-trimethyl-2,6-dioxo-10,10a-dihydro-9H-phenanthren-8a-yl)prop-2-ynoic acid.
| Compound Name | 3-(3,7-dicyano-1,1,4a-trimethyl-2,6-dioxo-10,10a-dihydro-9H-phenanthren-8a-yl)prop-2-ynoic acid |
|---|---|
| PubChem CID | 24956183 |
| Molecular Formula | C22H18N2O4 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | 3-(3,7-dicyano-1,1,4a-trimethyl-2,6-dioxo-10,10a-dihydro-9H-phenanthren-8a-yl)prop-2-ynoic acid |
| SMILES | CC1(C)C(=O)C(C#N)=CC2(C)C3=CC(=O)C(C#N)=CC3(C#CC(=O)O)CCC12 |
| InChI | InChI=1S/C22H18N2O4/c1-20(2)16-4-6-22(7-5-18(26)27)10-13(11-23)15(25)8-17(22)21(16,3)9-14(12-24)19(20)28/h8-10,16H,4,6H2,1-3H3,(H,26,27) |
| InChIKey | BCHKNBWBHPCRDI-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 119.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|