C19H18N2O2S — CID 88883489
4b,8,8-trimethyl-3,7-dioxo-10a-sulfanyl-9,10-dihydro-8aH-phenanthrene-2,6-dicarbonitrile (PubChem CID 88883489) has the molecular formula C19H18N2O2S and a molecular weight of 338.43 g/mol. Its IUPAC name is 4b,8,8-trimethyl-3,7-dioxo-10a-sulfanyl-9,10-dihydro-8aH-phenanthrene-2,6-dicarbonitrile.
| Compound Name | 4b,8,8-trimethyl-3,7-dioxo-10a-sulfanyl-9,10-dihydro-8aH-phenanthrene-2,6-dicarbonitrile |
|---|---|
| PubChem CID | 88883489 |
| Molecular Formula | C19H18N2O2S |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | 4b,8,8-trimethyl-3,7-dioxo-10a-sulfanyl-9,10-dihydro-8aH-phenanthrene-2,6-dicarbonitrile |
| SMILES | CC1(C)C(=O)C(C#N)=CC2(C)C3=CC(=O)C(C#N)=CC3(S)CCC12 |
| InChI | InChI=1S/C19H18N2O2S/c1-17(2)14-4-5-19(24)8-11(9-20)13(22)6-15(19)18(14,3)7-12(10-21)16(17)23/h6-8,14,24H,4-5H2,1-3H3 |
| InChIKey | MJHAWZSLFQFQPK-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 81.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|