C22H29NO2 — CID 71215573
(4aS,7R,8aS,10aR)-1,1,4a,8a-tetramethyl-2,6-dioxo-7-propyl-8,9,10,10a-tetrahydro-7H-phenanthrene-3-carbonitrile (PubChem CID 71215573) has the molecular formula C22H29NO2 and a molecular weight of 339.48 g/mol. Its IUPAC name is (4aS,7R,8aS,10aR)-1,1,4a,8a-tetramethyl-2,6-dioxo-7-propyl-8,9,10,10a-tetrahydro-7H-phenanthrene-3-carbonitrile.
| Compound Name | (4aS,7R,8aS,10aR)-1,1,4a,8a-tetramethyl-2,6-dioxo-7-propyl-8,9,10,10a-tetrahydro-7H-phenanthrene-3-carbonitrile |
|---|---|
| PubChem CID | 71215573 |
| Molecular Formula | C22H29NO2 |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.22 |
| IUPAC Name | (4aS,7R,8aS,10aR)-1,1,4a,8a-tetramethyl-2,6-dioxo-7-propyl-8,9,10,10a-tetrahydro-7H-phenanthrene-3-carbonitrile |
| SMILES | CCC[C@@H]1C[C@]2(C)CC[C@H]3C(C)(C)C(=O)C(C#N)=C[C@]3(C)C2=CC1=O |
| InChI | InChI=1S/C22H29NO2/c1-6-7-14-11-21(4)9-8-17-20(2,3)19(25)15(13-23)12-22(17,5)18(21)10-16(14)24/h10,12,14,17H,6-9,11H2,1-5H3/t14-,17+,21+,22+/m1/s1 |
| InChIKey | ZOSCWCCXPKFODI-XCAIGLTISA-N |
| XLogP | 4.78 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |