C30H42N2O2 — CID 146506119
(4aR,6aS,6bR,8aS,11S,12aS,14bS)-11-amino-4,4,6a,6b,8a,11,14b-heptamethyl-3,13-dioxo-4a,5,6,6a,7,8,9,10,12,12a-decahydropicene-2-carbonitrile (PubChem CID 146506119) has the molecular formula C30H42N2O2 and a molecular weight of 462.68 g/mol. Its IUPAC name is (4aR,6aS,6bR,8aS,11S,12aS,14bS)-11-amino-4,4,6a,6b,8a,11,14b-heptamethyl-3,13-dioxo-4a,5,6,6a,7,8,9,10,12,12a-decahydropicene-2-carbonitrile.
| Compound Name | (4aR,6aS,6bR,8aS,11S,12aS,14bS)-11-amino-4,4,6a,6b,8a,11,14b-heptamethyl-3,13-dioxo-4a,5,6,6a,7,8,9,10,12,12a-decahydropicene-2-carbonitrile |
|---|---|
| PubChem CID | 146506119 |
| Molecular Formula | C30H42N2O2 |
| Molecular Weight | 462.68 g/mol |
| Exact Mass | 462.32 |
| IUPAC Name | (4aR,6aS,6bR,8aS,11S,12aS,14bS)-11-amino-4,4,6a,6b,8a,11,14b-heptamethyl-3,13-dioxo-4a,5,6,6a,7,8,9,10,12,12a-decahydropicene-2-carbonitrile |
| SMILES | CC1(C)C(=O)C(C#N)=C[C@]2(C)C3=CC(=O)C4[C@@H]5C[C@@](C)(N)CC[C@]5(C)CC[C@@]4(C)[C@]3(C)CC[C@@H]12 |
| InChI | InChI=1S/C30H42N2O2/c1-25(2)21-8-9-29(6)22(28(21,5)15-18(17-31)24(25)34)14-20(33)23-19-16-27(4,32)12-10-26(19,3)11-13-30(23,29)7/h14-15,19,21,23H,8-13,16,32H2,1-7H3/t19-,21-,23?,26+,27-,28-,29+,30+/m0/s1 |
| InChIKey | DDMQVOUBLOMZGR-SNTBGRBRSA-N |
| XLogP | 5.92 |
| TPSA | 83.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.68 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |