C33H45NO4 — CID 146506400
methyl 2-[(2S,4aR,6aR,6bS,8aR,12aS,14bS)-11-cyano-2,4a,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-1,3,4,5,6,7,8,8a,14a,14b-decahydropicen-2-yl]acetate (PubChem CID 146506400) has the molecular formula C33H45NO4 and a molecular weight of 519.73 g/mol. Its IUPAC name is methyl 2-[(2S,4aR,6aR,6bS,8aR,12aS,14bS)-11-cyano-2,4a,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-1,3,4,5,6,7,8,8a,14a,14b-decahydropicen-2-yl]acetate.
| Compound Name | methyl 2-[(2S,4aR,6aR,6bS,8aR,12aS,14bS)-11-cyano-2,4a,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-1,3,4,5,6,7,8,8a,14a,14b-decahydropicen-2-yl]acetate |
|---|---|
| PubChem CID | 146506400 |
| Molecular Formula | C33H45NO4 |
| Molecular Weight | 519.73 g/mol |
| Exact Mass | 519.33 |
| IUPAC Name | methyl 2-[(2S,4aR,6aR,6bS,8aR,12aS,14bS)-11-cyano-2,4a,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-1,3,4,5,6,7,8,8a,14a,14b-decahydropicen-2-yl]acetate |
| SMILES | COC(=O)C[C@@]1(C)CC[C@]2(C)CC[C@]3(C)C(C(=O)C=C4[C@@]5(C)C=C(C#N)C(=O)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]2C1 |
| InChI | InChI=1S/C33H45NO4/c1-28(2)23-9-10-32(6)24(31(23,5)16-20(19-34)27(28)37)15-22(35)26-21-17-29(3,18-25(36)38-8)11-12-30(21,4)13-14-33(26,32)7/h15-16,21,23,26H,9-14,17-18H2,1-8H3/t21-,23-,26?,29-,30+,31-,32+,33+/m0/s1 |
| InChIKey | XXDUZFYDVUOFOP-UZHRFLFDSA-N |
| XLogP | 6.77 |
| TPSA | 84.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.73 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |