C35H55NO3 — CID 126683438
(4aS,8R,8aS,10aR)-8-[(3S)-3-(2-methoxyethyl)-3,6,6-trimethyloctyl]-1,1,4a,7,8,8a-hexamethyl-2,6-dioxo-7,9,10,10a-tetrahydrophenanthrene-3-carbonitrile (PubChem CID 126683438) has the molecular formula C35H55NO3 and a molecular weight of 537.83 g/mol. Its IUPAC name is (4aS,8R,8aS,10aR)-8-[(3S)-3-(2-methoxyethyl)-3,6,6-trimethyloctyl]-1,1,4a,7,8,8a-hexamethyl-2,6-dioxo-7,9,10,10a-tetrahydrophenanthrene-3-carbonitrile.
| Compound Name | (4aS,8R,8aS,10aR)-8-[(3S)-3-(2-methoxyethyl)-3,6,6-trimethyloctyl]-1,1,4a,7,8,8a-hexamethyl-2,6-dioxo-7,9,10,10a-tetrahydrophenanthrene-3-carbonitrile |
|---|---|
| PubChem CID | 126683438 |
| Molecular Formula | C35H55NO3 |
| Molecular Weight | 537.83 g/mol |
| Exact Mass | 537.42 |
| IUPAC Name | (4aS,8R,8aS,10aR)-8-[(3S)-3-(2-methoxyethyl)-3,6,6-trimethyloctyl]-1,1,4a,7,8,8a-hexamethyl-2,6-dioxo-7,9,10,10a-tetrahydrophenanthrene-3-carbonitrile |
| SMILES | CCC(C)(C)CC[C@](C)(CCOC)CC[C@]1(C)C(C)C(=O)C=C2[C@@]3(C)C=C(C#N)C(=O)C(C)(C)[C@@H]3CC[C@]21C |
| InChI | InChI=1S/C35H55NO3/c1-12-30(3,4)15-16-32(7,19-20-39-11)17-18-34(9)24(2)26(37)21-28-33(8)22-25(23-36)29(38)31(5,6)27(33)13-14-35(28,34)10/h21-22,24,27H,12-20H2,1-11H3/t24?,27-,32-,33-,34+,35+/m0/s1 |
| InChIKey | CCVCLWBMYRBSOX-HWNZHHNHSA-N |
| XLogP | 8.66 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.83 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |