C34H49N3O3 — CID 118121569
(4aS,8R,8aS,10aR)-1,1,4a,8,8a-pentamethyl-2,6-dioxo-8-[(3S)-3,6,6-trimethyl-3-(1,3,4-oxadiazol-2-yl)nonyl]-7,9,10,10a-tetrahydrophenanthrene-3-carbonitrile (PubChem CID 118121569) has the molecular formula C34H49N3O3 and a molecular weight of 547.78 g/mol. Its IUPAC name is (4aS,8R,8aS,10aR)-1,1,4a,8,8a-pentamethyl-2,6-dioxo-8-[(3S)-3,6,6-trimethyl-3-(1,3,4-oxadiazol-2-yl)nonyl]-7,9,10,10a-tetrahydrophenanthrene-3-carbonitrile.
| Compound Name | (4aS,8R,8aS,10aR)-1,1,4a,8,8a-pentamethyl-2,6-dioxo-8-[(3S)-3,6,6-trimethyl-3-(1,3,4-oxadiazol-2-yl)nonyl]-7,9,10,10a-tetrahydrophenanthrene-3-carbonitrile |
|---|---|
| PubChem CID | 118121569 |
| Molecular Formula | C34H49N3O3 |
| Molecular Weight | 547.78 g/mol |
| Exact Mass | 547.38 |
| IUPAC Name | (4aS,8R,8aS,10aR)-1,1,4a,8,8a-pentamethyl-2,6-dioxo-8-[(3S)-3,6,6-trimethyl-3-(1,3,4-oxadiazol-2-yl)nonyl]-7,9,10,10a-tetrahydrophenanthrene-3-carbonitrile |
| SMILES | CCCC(C)(C)CC[C@@](C)(CC[C@]1(C)CC(=O)C=C2[C@@]3(C)C=C(C#N)C(=O)C(C)(C)[C@@H]3CC[C@]21C)c1nnco1 |
| InChI | InChI=1S/C34H49N3O3/c1-10-12-29(2,3)14-15-31(6,28-37-36-22-40-28)16-17-32(7)20-24(38)18-26-33(8)19-23(21-35)27(39)30(4,5)25(33)11-13-34(26,32)9/h18-19,22,25H,10-17,20H2,1-9H3/t25-,31-,32+,33-,34+/m0/s1 |
| InChIKey | MNOWROSJHSKYMZ-HWRQDYOMSA-N |
| XLogP | 8.10 |
| TPSA | 96.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.78 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |