C37H57NO4 — CID 126683459
methyl (E,4S)-4-[3-[(1Z,2S,4aR,8aS)-7-cyano-2,5,5,8a-tetramethyl-6-oxo-1-(2-oxopropylidene)-4,4a-dihydro-3H-naphthalen-2-yl]-3-methylbutyl]-4,7,7-trimethyldec-2-enoate (PubChem CID 126683459) has the molecular formula C37H57NO4 and a molecular weight of 579.87 g/mol. Its IUPAC name is methyl (E,4S)-4-[3-[(1Z,2S,4aR,8aS)-7-cyano-2,5,5,8a-tetramethyl-6-oxo-1-(2-oxopropylidene)-4,4a-dihydro-3H-naphthalen-2-yl]-3-methylbutyl]-4,7,7-trimethyldec-2-enoate.
| Compound Name | methyl (E,4S)-4-[3-[(1Z,2S,4aR,8aS)-7-cyano-2,5,5,8a-tetramethyl-6-oxo-1-(2-oxopropylidene)-4,4a-dihydro-3H-naphthalen-2-yl]-3-methylbutyl]-4,7,7-trimethyldec-2-enoate |
|---|---|
| PubChem CID | 126683459 |
| Molecular Formula | C37H57NO4 |
| Molecular Weight | 579.87 g/mol |
| Exact Mass | 579.43 |
| IUPAC Name | methyl (E,4S)-4-[3-[(1Z,2S,4aR,8aS)-7-cyano-2,5,5,8a-tetramethyl-6-oxo-1-(2-oxopropylidene)-4,4a-dihydro-3H-naphthalen-2-yl]-3-methylbutyl]-4,7,7-trimethyldec-2-enoate |
| SMILES | CCCC(C)(C)CC[C@](C)(/C=C/C(=O)OC)CCC(C)(C)[C@]1(C)CC[C@H]2C(C)(C)C(=O)C(C#N)=C[C@]2(C)/C1=C/C(C)=O |
| InChI | InChI=1S/C37H57NO4/c1-13-16-32(3,4)19-21-35(9,17-15-30(40)42-12)22-20-33(5,6)37(11)18-14-28-34(7,8)31(41)27(25-38)24-36(28,10)29(37)23-26(2)39/h15,17,23-24,28H,13-14,16,18-22H2,1-12H3/b17-15+,29-23-/t28-,35-,36-,37+/m0/s1 |
| InChIKey | CVDWLNPQNUWOLG-WDDRPFERSA-N |
| XLogP | 9.13 |
| TPSA | 84.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.87 |
| LogP ≤ 5 | 9.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|