C32H49FN2O3 — CID 178062986
(8Z)-7-[4-(3,3-dimethylbutyl)-1,4-dimethylcyclohexyl]-4,4,7,8a-tetramethyl-3-oxo-8-(2-oxoethylidene)-5,6-dihydro-4aH-naphthalene-2-carbonitrile;N-fluoroformamide (PubChem CID 178062986) has the molecular formula C32H49FN2O3 and a molecular weight of 528.75 g/mol. Its IUPAC name is (8Z)-7-[4-(3,3-dimethylbutyl)-1,4-dimethylcyclohexyl]-4,4,7,8a-tetramethyl-3-oxo-8-(2-oxoethylidene)-5,6-dihydro-4aH-naphthalene-2-carbonitrile;N-fluoroformamide.
| Compound Name | (8Z)-7-[4-(3,3-dimethylbutyl)-1,4-dimethylcyclohexyl]-4,4,7,8a-tetramethyl-3-oxo-8-(2-oxoethylidene)-5,6-dihydro-4aH-naphthalene-2-carbonitrile;N-fluoroformamide |
|---|---|
| PubChem CID | 178062986 |
| Molecular Formula | C32H49FN2O3 |
| Molecular Weight | 528.75 g/mol |
| Exact Mass | 528.37 |
| IUPAC Name | (8Z)-7-[4-(3,3-dimethylbutyl)-1,4-dimethylcyclohexyl]-4,4,7,8a-tetramethyl-3-oxo-8-(2-oxoethylidene)-5,6-dihydro-4aH-naphthalene-2-carbonitrile;N-fluoroformamide |
| SMILES | CC(C)(C)CCC1(C)CCC(C)(C2(C)CCC3C(C)(C)C(=O)C(C#N)=CC3(C)/C2=C/C=O)CC1.O=CNF |
| InChI | InChI=1S/C31H47NO2.CH2FNO/c1-26(2,3)13-14-28(6)15-17-29(7,18-16-28)31(9)12-10-23-27(4,5)25(34)22(21-32)20-30(23,8)24(31)11-19-33;2-3-1-4/h11,19-20,23H,10,12-18H2,1-9H3;1H,(H,3,4)/b24-11-; |
| InChIKey | YKVWYOIRPQXBEH-VAYBTIOZSA-N |
| XLogP | 7.62 |
| TPSA | 87.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.75 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|