C32H47NO4 — CID 118963482
methyl (1S)-1-[3-[(1Z,2S,4aS,8aR)-7-cyano-2,8a-dimethyl-6-oxo-1-(2-oxopropylidene)-3,4,4a,5-tetrahydronaphthalen-2-yl]-3-methylbutyl]-2,4,4-trimethylcyclohexane-1-carboxylate (PubChem CID 118963482) has the molecular formula C32H47NO4 and a molecular weight of 509.73 g/mol. Its IUPAC name is methyl (1S)-1-[3-[(1Z,2S,4aS,8aR)-7-cyano-2,8a-dimethyl-6-oxo-1-(2-oxopropylidene)-3,4,4a,5-tetrahydronaphthalen-2-yl]-3-methylbutyl]-2,4,4-trimethylcyclohexane-1-carboxylate.
| Compound Name | methyl (1S)-1-[3-[(1Z,2S,4aS,8aR)-7-cyano-2,8a-dimethyl-6-oxo-1-(2-oxopropylidene)-3,4,4a,5-tetrahydronaphthalen-2-yl]-3-methylbutyl]-2,4,4-trimethylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 118963482 |
| Molecular Formula | C32H47NO4 |
| Molecular Weight | 509.73 g/mol |
| Exact Mass | 509.35 |
| IUPAC Name | methyl (1S)-1-[3-[(1Z,2S,4aS,8aR)-7-cyano-2,8a-dimethyl-6-oxo-1-(2-oxopropylidene)-3,4,4a,5-tetrahydronaphthalen-2-yl]-3-methylbutyl]-2,4,4-trimethylcyclohexane-1-carboxylate |
| SMILES | COC(=O)[C@]1(CCC(C)(C)[C@]2(C)CC[C@H]3CC(=O)C(C#N)=C[C@]3(C)/C2=C/C(C)=O)CCC(C)(C)CC1C |
| InChI | InChI=1S/C32H47NO4/c1-21-18-28(3,4)12-14-32(21,27(36)37-9)15-13-29(5,6)31(8)11-10-24-17-25(35)23(20-33)19-30(24,7)26(31)16-22(2)34/h16,19,21,24H,10-15,17-18H2,1-9H3/b26-16-/t21?,24-,30-,31+,32-/m0/s1 |
| InChIKey | ATYHFRFXHHYRIK-LTNIDMNASA-N |
| XLogP | 7.16 |
| TPSA | 84.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.73 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|