C39H62N2O5 — CID 130426667
[(2S)-2-[3-[(1Z,2S,4aR,8aS)-7-cyano-2,5,5,8a-tetramethyl-6-oxo-1-(2-oxopropylidene)-4,4a-dihydro-3H-naphthalen-2-yl]-3-methylbutyl]-2,5,5-trimethyloctyl] morpholine-4-carboxylate (PubChem CID 130426667) has the molecular formula C39H62N2O5 and a molecular weight of 638.93 g/mol. Its IUPAC name is [(2S)-2-[3-[(1Z,2S,4aR,8aS)-7-cyano-2,5,5,8a-tetramethyl-6-oxo-1-(2-oxopropylidene)-4,4a-dihydro-3H-naphthalen-2-yl]-3-methylbutyl]-2,5,5-trimethyloctyl] morpholine-4-carboxylate.
| Compound Name | [(2S)-2-[3-[(1Z,2S,4aR,8aS)-7-cyano-2,5,5,8a-tetramethyl-6-oxo-1-(2-oxopropylidene)-4,4a-dihydro-3H-naphthalen-2-yl]-3-methylbutyl]-2,5,5-trimethyloctyl] morpholine-4-carboxylate |
|---|---|
| PubChem CID | 130426667 |
| Molecular Formula | C39H62N2O5 |
| Molecular Weight | 638.93 g/mol |
| Exact Mass | 638.47 |
| IUPAC Name | [(2S)-2-[3-[(1Z,2S,4aR,8aS)-7-cyano-2,5,5,8a-tetramethyl-6-oxo-1-(2-oxopropylidene)-4,4a-dihydro-3H-naphthalen-2-yl]-3-methylbutyl]-2,5,5-trimethyloctyl] morpholine-4-carboxylate |
| SMILES | CCCC(C)(C)CC[C@@](C)(CCC(C)(C)[C@]1(C)CC[C@H]2C(C)(C)C(=O)C(C#N)=C[C@]2(C)/C1=C/C(C)=O)COC(=O)N1CCOCC1 |
| InChI | InChI=1S/C39H62N2O5/c1-12-14-34(3,4)16-18-37(9,27-46-33(44)41-20-22-45-23-21-41)19-17-35(5,6)39(11)15-13-30-36(7,8)32(43)29(26-40)25-38(30,10)31(39)24-28(2)42/h24-25,30H,12-23,27H2,1-11H3/b31-24-/t30-,37-,38-,39+/m0/s1 |
| InChIKey | CCAGLSRYMDLTHD-ZVSVNHKOSA-N |
| XLogP | 8.87 |
| TPSA | 96.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.93 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|