C36H57NO4 — CID 126683407
methyl 3-[(1R)-1-[3-[(1Z,2S,4aR,8aS)-7-cyano-6-hydroxy-2,5,5,8a-tetramethyl-1-(2-oxopropylidene)-3,4,4a,8-tetrahydronaphthalen-2-yl]-3-methylbutyl]-2,4,4-trimethylcyclohexyl]propanoate (PubChem CID 126683407) has the molecular formula C36H57NO4 and a molecular weight of 567.86 g/mol. Its IUPAC name is methyl 3-[(1R)-1-[3-[(1Z,2S,4aR,8aS)-7-cyano-6-hydroxy-2,5,5,8a-tetramethyl-1-(2-oxopropylidene)-3,4,4a,8-tetrahydronaphthalen-2-yl]-3-methylbutyl]-2,4,4-trimethylcyclohexyl]propanoate.
| Compound Name | methyl 3-[(1R)-1-[3-[(1Z,2S,4aR,8aS)-7-cyano-6-hydroxy-2,5,5,8a-tetramethyl-1-(2-oxopropylidene)-3,4,4a,8-tetrahydronaphthalen-2-yl]-3-methylbutyl]-2,4,4-trimethylcyclohexyl]propanoate |
|---|---|
| PubChem CID | 126683407 |
| Molecular Formula | C36H57NO4 |
| Molecular Weight | 567.86 g/mol |
| Exact Mass | 567.43 |
| IUPAC Name | methyl 3-[(1R)-1-[3-[(1Z,2S,4aR,8aS)-7-cyano-6-hydroxy-2,5,5,8a-tetramethyl-1-(2-oxopropylidene)-3,4,4a,8-tetrahydronaphthalen-2-yl]-3-methylbutyl]-2,4,4-trimethylcyclohexyl]propanoate |
| SMILES | COC(=O)CC[C@]1(CCC(C)(C)[C@]2(C)CC[C@H]3C(C)(C)C(O)=C(C#N)C[C@]3(C)/C2=C/C(C)=O)CCC(C)(C)CC1C |
| InChI | InChI=1S/C36H57NO4/c1-24-21-31(3,4)16-18-36(24,15-13-29(39)41-11)19-17-32(5,6)35(10)14-12-27-33(7,8)30(40)26(23-37)22-34(27,9)28(35)20-25(2)38/h20,24,27,40H,12-19,21-22H2,1-11H3/b28-20-/t24?,27-,34-,35+,36+/m0/s1 |
| InChIKey | BWPIURXEZCTGIM-OUDXLGLTSA-N |
| XLogP | 9.28 |
| TPSA | 87.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.86 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|