C31H45NO4 — CID 143880661
methyl 11-cyano-10-hydroxy-2,2,6b,9,9,12a-hexamethyl-14-oxo-1,3,4,5,6,6a,6a,7,8,8a,12,13,14a,14b-tetradecahydropicene-4a-carboxylate (PubChem CID 143880661) has the molecular formula C31H45NO4 and a molecular weight of 495.70 g/mol. Its IUPAC name is methyl 11-cyano-10-hydroxy-2,2,6b,9,9,12a-hexamethyl-14-oxo-1,3,4,5,6,6a,6a,7,8,8a,12,13,14a,14b-tetradecahydropicene-4a-carboxylate.
| Compound Name | methyl 11-cyano-10-hydroxy-2,2,6b,9,9,12a-hexamethyl-14-oxo-1,3,4,5,6,6a,6a,7,8,8a,12,13,14a,14b-tetradecahydropicene-4a-carboxylate |
|---|---|
| PubChem CID | 143880661 |
| Molecular Formula | C31H45NO4 |
| Molecular Weight | 495.70 g/mol |
| Exact Mass | 495.33 |
| IUPAC Name | methyl 11-cyano-10-hydroxy-2,2,6b,9,9,12a-hexamethyl-14-oxo-1,3,4,5,6,6a,6a,7,8,8a,12,13,14a,14b-tetradecahydropicene-4a-carboxylate |
| SMILES | COC(=O)C12CCC3C(C(=O)CC4C3(C)CCC3C(C)(C)C(O)=C(C#N)CC34C)C1CC(C)(C)CC2 |
| InChI | InChI=1S/C31H45NO4/c1-27(2)12-13-31(26(35)36-7)11-8-19-24(20(31)16-27)21(33)14-23-29(19,5)10-9-22-28(3,4)25(34)18(17-32)15-30(22,23)6/h19-20,22-24,34H,8-16H2,1-7H3 |
| InChIKey | JXACQMBNTBAMOS-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 87.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.70 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |