C30H43NO3 — CID 143880640
methyl 11-cyano-2,2,6b,9,12a-pentamethyl-10-oxo-3,4,5,6,6a,6a,7,8,8a,9,13,14,14a,14b-tetradecahydro-1H-picene-4a-carboxylate (PubChem CID 143880640) has the molecular formula C30H43NO3 and a molecular weight of 465.68 g/mol. Its IUPAC name is methyl 11-cyano-2,2,6b,9,12a-pentamethyl-10-oxo-3,4,5,6,6a,6a,7,8,8a,9,13,14,14a,14b-tetradecahydro-1H-picene-4a-carboxylate.
| Compound Name | methyl 11-cyano-2,2,6b,9,12a-pentamethyl-10-oxo-3,4,5,6,6a,6a,7,8,8a,9,13,14,14a,14b-tetradecahydro-1H-picene-4a-carboxylate |
|---|---|
| PubChem CID | 143880640 |
| Molecular Formula | C30H43NO3 |
| Molecular Weight | 465.68 g/mol |
| Exact Mass | 465.32 |
| IUPAC Name | methyl 11-cyano-2,2,6b,9,12a-pentamethyl-10-oxo-3,4,5,6,6a,6a,7,8,8a,9,13,14,14a,14b-tetradecahydro-1H-picene-4a-carboxylate |
| SMILES | COC(=O)C12CCC3C(CCC4C5(C)C=C(C#N)C(=O)C(C)C5CCC34C)C1CC(C)(C)CC2 |
| InChI | InChI=1S/C30H43NO3/c1-18-21-9-11-28(4)22-10-12-30(26(33)34-6)14-13-27(2,3)16-23(30)20(22)7-8-24(28)29(21,5)15-19(17-31)25(18)32/h15,18,20-24H,7-14,16H2,1-6H3 |
| InChIKey | IFVUEIPRVFHRTI-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.68 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |