C31H46N2O3 — CID 143880604
11-cyano-2,2,6b,9,12a-pentamethyl-10,14-dioxo-1,3,4,5,6,6a,6a,7,8,8a,9,13,14a,14b-tetradecahydropicene-4a-carboxamide;ethane (PubChem CID 143880604) has the molecular formula C31H46N2O3 and a molecular weight of 494.72 g/mol. Its IUPAC name is 11-cyano-2,2,6b,9,12a-pentamethyl-10,14-dioxo-1,3,4,5,6,6a,6a,7,8,8a,9,13,14a,14b-tetradecahydropicene-4a-carboxamide;ethane.
| Compound Name | 11-cyano-2,2,6b,9,12a-pentamethyl-10,14-dioxo-1,3,4,5,6,6a,6a,7,8,8a,9,13,14a,14b-tetradecahydropicene-4a-carboxamide;ethane |
|---|---|
| PubChem CID | 143880604 |
| Molecular Formula | C31H46N2O3 |
| Molecular Weight | 494.72 g/mol |
| Exact Mass | 494.35 |
| IUPAC Name | 11-cyano-2,2,6b,9,12a-pentamethyl-10,14-dioxo-1,3,4,5,6,6a,6a,7,8,8a,9,13,14a,14b-tetradecahydropicene-4a-carboxamide;ethane |
| SMILES | CC.CC1C(=O)C(C#N)=CC2(C)C1CCC1(C)C3CCC4(C(N)=O)CCC(C)(C)CC4C3C(=O)CC21 |
| InChI | InChI=1S/C29H40N2O3.C2H6/c1-16-18-6-8-27(4)19-7-9-29(25(31)34)11-10-26(2,3)14-20(29)23(19)21(32)12-22(27)28(18,5)13-17(15-30)24(16)33;1-2/h13,16,18-20,22-23H,6-12,14H2,1-5H3,(H2,31,34);1-2H3 |
| InChIKey | FKYANSAOALKTMK-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 101.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.72 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |