C32H47NO3 — CID 170092918
(4S,4aS,6aR,6bR,8aS,14aR,14bR)-8a-(ethoxymethyl)-4,6a,6b,11,11,14b-hexamethyl-3,13-dioxo-4a,5,6,6a,7,8,9,10,12,12a,14,14a-dodecahydro-4H-picene-2-carbonitrile (PubChem CID 170092918) has the molecular formula C32H47NO3 and a molecular weight of 493.73 g/mol. Its IUPAC name is (4S,4aS,6aR,6bR,8aS,14aR,14bR)-8a-(ethoxymethyl)-4,6a,6b,11,11,14b-hexamethyl-3,13-dioxo-4a,5,6,6a,7,8,9,10,12,12a,14,14a-dodecahydro-4H-picene-2-carbonitrile.
| Compound Name | (4S,4aS,6aR,6bR,8aS,14aR,14bR)-8a-(ethoxymethyl)-4,6a,6b,11,11,14b-hexamethyl-3,13-dioxo-4a,5,6,6a,7,8,9,10,12,12a,14,14a-dodecahydro-4H-picene-2-carbonitrile |
|---|---|
| PubChem CID | 170092918 |
| Molecular Formula | C32H47NO3 |
| Molecular Weight | 493.73 g/mol |
| Exact Mass | 493.36 |
| IUPAC Name | (4S,4aS,6aR,6bR,8aS,14aR,14bR)-8a-(ethoxymethyl)-4,6a,6b,11,11,14b-hexamethyl-3,13-dioxo-4a,5,6,6a,7,8,9,10,12,12a,14,14a-dodecahydro-4H-picene-2-carbonitrile |
| SMILES | CCOC[C@]12CCC(C)(C)CC1C1C(=O)C[C@@H]3[C@@]4(C)C=C(C#N)C(=O)[C@@H](C)[C@@H]4CC[C@@]3(C)[C@]1(C)CC2 |
| InChI | InChI=1S/C32H47NO3/c1-8-36-19-32-13-11-28(3,4)17-23(32)26-24(34)15-25-29(5)16-21(18-33)27(35)20(2)22(29)9-10-30(25,6)31(26,7)12-14-32/h16,20,22-23,25-26H,8-15,17,19H2,1-7H3/t20-,22-,23?,25+,26?,29-,30+,31+,32+/m0/s1 |
| InChIKey | UHKNWDLNNYPRIE-BERCAWFNSA-N |
| XLogP | 6.93 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.73 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |