C32H45NO2 — CID 89429211
(6aR,6bR,8aR,14aR,14bR)-8a-ethenyl-4,4,6a,6b,11,11,14b-heptamethyl-3,13-dioxo-4a,5,6,6a,7,8,9,10,12,12a,14,14a-dodecahydropicene-2-carbonitrile (PubChem CID 89429211) has the molecular formula C32H45NO2 and a molecular weight of 475.72 g/mol. Its IUPAC name is (6aR,6bR,8aR,14aR,14bR)-8a-ethenyl-4,4,6a,6b,11,11,14b-heptamethyl-3,13-dioxo-4a,5,6,6a,7,8,9,10,12,12a,14,14a-dodecahydropicene-2-carbonitrile.
| Compound Name | (6aR,6bR,8aR,14aR,14bR)-8a-ethenyl-4,4,6a,6b,11,11,14b-heptamethyl-3,13-dioxo-4a,5,6,6a,7,8,9,10,12,12a,14,14a-dodecahydropicene-2-carbonitrile |
|---|---|
| PubChem CID | 89429211 |
| Molecular Formula | C32H45NO2 |
| Molecular Weight | 475.72 g/mol |
| Exact Mass | 475.35 |
| IUPAC Name | (6aR,6bR,8aR,14aR,14bR)-8a-ethenyl-4,4,6a,6b,11,11,14b-heptamethyl-3,13-dioxo-4a,5,6,6a,7,8,9,10,12,12a,14,14a-dodecahydropicene-2-carbonitrile |
| SMILES | C=C[C@]12CCC(C)(C)CC1C1C(=O)C[C@@H]3[C@@]4(C)C=C(C#N)C(=O)C(C)(C)C4CC[C@@]3(C)[C@]1(C)CC2 |
| InChI | InChI=1S/C32H45NO2/c1-9-32-14-12-27(2,3)18-21(32)25-22(34)16-24-29(6)17-20(19-33)26(35)28(4,5)23(29)10-11-30(24,7)31(25,8)13-15-32/h9,17,21,23-25H,1,10-16,18H2,2-8H3/t21?,23?,24-,25?,29+,30-,31-,32-/m1/s1 |
| InChIKey | WQXNYJFEYNHADY-ZRSFGOFKSA-N |
| XLogP | 7.47 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.72 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|