C32H46ClNO3 — CID 170092390
(4aR,6aR,6bR,8aS,12aR,14aR,14bR)-8a-(2-chloro-1-hydroxyethyl)-4,4,6a,6b,11,11,14b-heptamethyl-3,13-dioxo-4a,5,6,6a,7,8,9,10,12,12a,14,14a-dodecahydropicene-2-carbonitrile (PubChem CID 170092390) has the molecular formula C32H46ClNO3 and a molecular weight of 528.18 g/mol. Its IUPAC name is (4aR,6aR,6bR,8aS,12aR,14aR,14bR)-8a-(2-chloro-1-hydroxyethyl)-4,4,6a,6b,11,11,14b-heptamethyl-3,13-dioxo-4a,5,6,6a,7,8,9,10,12,12a,14,14a-dodecahydropicene-2-carbonitrile.
| Compound Name | (4aR,6aR,6bR,8aS,12aR,14aR,14bR)-8a-(2-chloro-1-hydroxyethyl)-4,4,6a,6b,11,11,14b-heptamethyl-3,13-dioxo-4a,5,6,6a,7,8,9,10,12,12a,14,14a-dodecahydropicene-2-carbonitrile |
|---|---|
| PubChem CID | 170092390 |
| Molecular Formula | C32H46ClNO3 |
| Molecular Weight | 528.18 g/mol |
| Exact Mass | 527.32 |
| IUPAC Name | (4aR,6aR,6bR,8aS,12aR,14aR,14bR)-8a-(2-chloro-1-hydroxyethyl)-4,4,6a,6b,11,11,14b-heptamethyl-3,13-dioxo-4a,5,6,6a,7,8,9,10,12,12a,14,14a-dodecahydropicene-2-carbonitrile |
| SMILES | CC1(C)CC[C@]2(C(O)CCl)CC[C@]3(C)C(C(=O)C[C@@H]4[C@@]5(C)C=C(C#N)C(=O)C(C)(C)[C@@H]5CC[C@]43C)[C@H]2C1 |
| InChI | InChI=1S/C32H46ClNO3/c1-27(2)10-12-32(24(36)17-33)13-11-31(7)25(20(32)16-27)21(35)14-23-29(5)15-19(18-34)26(37)28(3,4)22(29)8-9-30(23,31)6/h15,20,22-25,36H,8-14,16-17H2,1-7H3/t20-,22+,23-,24?,25?,29+,30-,31-,32+/m1/s1 |
| InChIKey | XEXVAHVDVOYCHX-NMCVEAACSA-N |
| XLogP | 6.89 |
| TPSA | 78.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.18 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|