C32H45NO3 — CID 87290226
(4aR,6aR,6aR,6bR,8aS,12aS,14aR,14bR)-4,4,6a,6b,11,11,14b-heptamethyl-8a-(oxiran-2-yl)-3,13-dioxo-4a,5,6,6a,7,8,9,10,12,12a,14,14a-dodecahydropicene-2-carbonitrile (PubChem CID 87290226) has the molecular formula C32H45NO3 and a molecular weight of 491.72 g/mol. Its IUPAC name is (4aR,6aR,6aR,6bR,8aS,12aS,14aR,14bR)-4,4,6a,6b,11,11,14b-heptamethyl-8a-(oxiran-2-yl)-3,13-dioxo-4a,5,6,6a,7,8,9,10,12,12a,14,14a-dodecahydropicene-2-carbonitrile.
| Compound Name | (4aR,6aR,6aR,6bR,8aS,12aS,14aR,14bR)-4,4,6a,6b,11,11,14b-heptamethyl-8a-(oxiran-2-yl)-3,13-dioxo-4a,5,6,6a,7,8,9,10,12,12a,14,14a-dodecahydropicene-2-carbonitrile |
|---|---|
| PubChem CID | 87290226 |
| Molecular Formula | C32H45NO3 |
| Molecular Weight | 491.72 g/mol |
| Exact Mass | 491.34 |
| IUPAC Name | (4aR,6aR,6aR,6bR,8aS,12aS,14aR,14bR)-4,4,6a,6b,11,11,14b-heptamethyl-8a-(oxiran-2-yl)-3,13-dioxo-4a,5,6,6a,7,8,9,10,12,12a,14,14a-dodecahydropicene-2-carbonitrile |
| SMILES | CC1(C)CC[C@]2(C3CO3)CC[C@]3(C)[C@H](C(=O)C[C@@H]4[C@@]5(C)C=C(C#N)C(=O)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]2C1 |
| InChI | InChI=1S/C32H45NO3/c1-27(2)10-12-32(24-18-36-24)13-11-31(7)25(20(32)16-27)21(34)14-23-29(5)15-19(17-33)26(35)28(3,4)22(29)8-9-30(23,31)6/h15,20,22-25H,8-14,16,18H2,1-7H3/t20-,22-,23+,24?,25-,29-,30+,31+,32-/m0/s1 |
| InChIKey | LZCSNKKGTMEVLO-MWRUXPMLSA-N |
| XLogP | 6.68 |
| TPSA | 70.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.72 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|