C37H49NO4S — CID 76791336
8a-(benzenesulfonylmethyl)-4,4,6a,6b,11,11,14b-heptamethyl-3,13-dioxo-4a,5,6,6a,7,8,9,10,12,12a,14,14a-dodecahydropicene-2-carbonitrile (PubChem CID 76791336) has the molecular formula C37H49NO4S and a molecular weight of 603.87 g/mol. Its IUPAC name is 8a-(benzenesulfonylmethyl)-4,4,6a,6b,11,11,14b-heptamethyl-3,13-dioxo-4a,5,6,6a,7,8,9,10,12,12a,14,14a-dodecahydropicene-2-carbonitrile.
| Compound Name | 8a-(benzenesulfonylmethyl)-4,4,6a,6b,11,11,14b-heptamethyl-3,13-dioxo-4a,5,6,6a,7,8,9,10,12,12a,14,14a-dodecahydropicene-2-carbonitrile |
|---|---|
| PubChem CID | 76791336 |
| Molecular Formula | C37H49NO4S |
| Molecular Weight | 603.87 g/mol |
| Exact Mass | 603.34 |
| IUPAC Name | 8a-(benzenesulfonylmethyl)-4,4,6a,6b,11,11,14b-heptamethyl-3,13-dioxo-4a,5,6,6a,7,8,9,10,12,12a,14,14a-dodecahydropicene-2-carbonitrile |
| SMILES | CC1(C)CCC2(CS(=O)(=O)c3ccccc3)CCC3(C)C(C(=O)CC4C5(C)C=C(C#N)C(=O)C(C)(C)C5CCC43C)C2C1 |
| InChI | InChI=1S/C37H49NO4S/c1-32(2)15-17-37(23-43(41,42)25-11-9-8-10-12-25)18-16-36(7)30(26(37)21-32)27(39)19-29-34(5)20-24(22-38)31(40)33(3,4)28(34)13-14-35(29,36)6/h8-12,20,26,28-30H,13-19,21,23H2,1-7H3 |
| InChIKey | NPVPFDJOKRUCPI-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 92.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.87 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |