C39H51NO4 — CID 163783911
[(1R,2R,5R,10R,21S)-8-cyano-1,2,6,6,10,18,18-heptamethyl-7,13-dioxo-21-pentacyclo[12.9.0.02,11.05,10.015,21]tricos-8-enyl]methyl benzoate (PubChem CID 163783911) has the molecular formula C39H51NO4 and a molecular weight of 597.84 g/mol. Its IUPAC name is [(1R,2R,5R,10R,21S)-8-cyano-1,2,6,6,10,18,18-heptamethyl-7,13-dioxo-21-pentacyclo[12.9.0.02,11.05,10.015,21]tricos-8-enyl]methyl benzoate.
| Compound Name | [(1R,2R,5R,10R,21S)-8-cyano-1,2,6,6,10,18,18-heptamethyl-7,13-dioxo-21-pentacyclo[12.9.0.02,11.05,10.015,21]tricos-8-enyl]methyl benzoate |
|---|---|
| PubChem CID | 163783911 |
| Molecular Formula | C39H51NO4 |
| Molecular Weight | 597.84 g/mol |
| Exact Mass | 597.38 |
| IUPAC Name | [(1R,2R,5R,10R,21S)-8-cyano-1,2,6,6,10,18,18-heptamethyl-7,13-dioxo-21-pentacyclo[12.9.0.02,11.05,10.015,21]tricos-8-enyl]methyl benzoate |
| SMILES | CC1(C)CCC2C3C(=O)CC4[C@@]5(C)C=C(C#N)C(=O)C(C)(C)[C@@H]5CC[C@@]4(C)[C@]3(C)CC[C@@]2(COC(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C39H51NO4/c1-34(2)15-13-27-31-28(41)21-30-36(5)22-26(23-40)32(42)35(3,4)29(36)14-16-37(30,6)38(31,7)18-20-39(27,19-17-34)24-44-33(43)25-11-9-8-10-12-25/h8-12,22,27,29-31H,13-21,24H2,1-7H3/t27?,29-,30?,31?,36-,37+,38+,39+/m0/s1 |
| InChIKey | MQXMNSXGRDFNKN-QBBGVJOLSA-N |
| XLogP | 8.53 |
| TPSA | 84.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.84 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |