C32H46N2O3 — CID 70961111
(2S,4aS,6aR,6bR,12aR)-11-cyano-N,N,2,6a,6b,9,9,12a-octamethyl-10,14-dioxo-2,3,4,5,6,6a,7,8,8a,13,14a,14b-dodecahydro-1H-picene-4a-carboxamide (PubChem CID 70961111) has the molecular formula C32H46N2O3 and a molecular weight of 506.73 g/mol. Its IUPAC name is (2S,4aS,6aR,6bR,12aR)-11-cyano-N,N,2,6a,6b,9,9,12a-octamethyl-10,14-dioxo-2,3,4,5,6,6a,7,8,8a,13,14a,14b-dodecahydro-1H-picene-4a-carboxamide.
| Compound Name | (2S,4aS,6aR,6bR,12aR)-11-cyano-N,N,2,6a,6b,9,9,12a-octamethyl-10,14-dioxo-2,3,4,5,6,6a,7,8,8a,13,14a,14b-dodecahydro-1H-picene-4a-carboxamide |
|---|---|
| PubChem CID | 70961111 |
| Molecular Formula | C32H46N2O3 |
| Molecular Weight | 506.73 g/mol |
| Exact Mass | 506.35 |
| IUPAC Name | (2S,4aS,6aR,6bR,12aR)-11-cyano-N,N,2,6a,6b,9,9,12a-octamethyl-10,14-dioxo-2,3,4,5,6,6a,7,8,8a,13,14a,14b-dodecahydro-1H-picene-4a-carboxamide |
| SMILES | C[C@H]1CC[C@]2(C(=O)N(C)C)CC[C@]3(C)C(C(=O)CC4[C@@]5(C)C=C(C#N)C(=O)C(C)(C)C5CC[C@]43C)C2C1 |
| InChI | InChI=1S/C32H46N2O3/c1-19-9-12-32(27(37)34(7)8)14-13-31(6)25(21(32)15-19)22(35)16-24-29(4)17-20(18-33)26(36)28(2,3)23(29)10-11-30(24,31)5/h17,19,21,23-25H,9-16H2,1-8H3/t19-,21?,23?,24?,25?,29-,30+,31+,32-/m0/s1 |
| InChIKey | GVJDZDRNEIJOMF-YEXYWRJUSA-N |
| XLogP | 5.98 |
| TPSA | 78.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.73 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |