C32H45N3O2 — CID 72530185
8a-(cyanomethylamino)-4,4,6a,6b,11,11,14b-heptamethyl-3,13-dioxo-4a,5,6,6a,7,8,9,10,12,12a,14,14a-dodecahydropicene-2-carbonitrile (PubChem CID 72530185) has the molecular formula C32H45N3O2 and a molecular weight of 503.73 g/mol. Its IUPAC name is 8a-(cyanomethylamino)-4,4,6a,6b,11,11,14b-heptamethyl-3,13-dioxo-4a,5,6,6a,7,8,9,10,12,12a,14,14a-dodecahydropicene-2-carbonitrile.
| Compound Name | 8a-(cyanomethylamino)-4,4,6a,6b,11,11,14b-heptamethyl-3,13-dioxo-4a,5,6,6a,7,8,9,10,12,12a,14,14a-dodecahydropicene-2-carbonitrile |
|---|---|
| PubChem CID | 72530185 |
| Molecular Formula | C32H45N3O2 |
| Molecular Weight | 503.73 g/mol |
| Exact Mass | 503.35 |
| IUPAC Name | 8a-(cyanomethylamino)-4,4,6a,6b,11,11,14b-heptamethyl-3,13-dioxo-4a,5,6,6a,7,8,9,10,12,12a,14,14a-dodecahydropicene-2-carbonitrile |
| SMILES | CC1(C)CCC2(NCC#N)CCC3(C)C(C(=O)CC4C5(C)C=C(C#N)C(=O)C(C)(C)C5CCC43C)C2C1 |
| InChI | InChI=1S/C32H45N3O2/c1-27(2)10-12-32(35-15-14-33)13-11-31(7)25(21(32)18-27)22(36)16-24-29(5)17-20(19-34)26(37)28(3,4)23(29)8-9-30(24,31)6/h17,21,23-25,35H,8-13,15-16,18H2,1-7H3 |
| InChIKey | XXCBFRLIMQKOQM-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 93.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.73 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|