C33H49NO2 — CID 143880827
8a-ethenyl-4,4,6a,11,11,14b-hexamethyl-3,13-dioxo-5,6,6a,6b,7,8,9,10,12,12a,14,14a-dodecahydro-4aH-picene-2-carbonitrile;ethane (PubChem CID 143880827) has the molecular formula C33H49NO2 and a molecular weight of 491.76 g/mol. Its IUPAC name is 8a-ethenyl-4,4,6a,11,11,14b-hexamethyl-3,13-dioxo-5,6,6a,6b,7,8,9,10,12,12a,14,14a-dodecahydro-4aH-picene-2-carbonitrile;ethane.
| Compound Name | 8a-ethenyl-4,4,6a,11,11,14b-hexamethyl-3,13-dioxo-5,6,6a,6b,7,8,9,10,12,12a,14,14a-dodecahydro-4aH-picene-2-carbonitrile;ethane |
|---|---|
| PubChem CID | 143880827 |
| Molecular Formula | C33H49NO2 |
| Molecular Weight | 491.76 g/mol |
| Exact Mass | 491.38 |
| IUPAC Name | 8a-ethenyl-4,4,6a,11,11,14b-hexamethyl-3,13-dioxo-5,6,6a,6b,7,8,9,10,12,12a,14,14a-dodecahydro-4aH-picene-2-carbonitrile;ethane |
| SMILES | C=CC12CCC3C(C(=O)CC4C5(C)C=C(C#N)C(=O)C(C)(C)C5CCC34C)C1CC(C)(C)CC2.CC |
| InChI | InChI=1S/C31H43NO2.C2H6/c1-8-31-12-9-20-25(21(31)17-27(2,3)13-14-31)22(33)15-24-29(20,6)11-10-23-28(4,5)26(34)19(18-32)16-30(23,24)7;1-2/h8,16,20-21,23-25H,1,9-15,17H2,2-7H3;1-2H3 |
| InChIKey | NDETWZIIZHLSAD-UHFFFAOYSA-N |
| XLogP | 8.11 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.76 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|