C33H46F3NO4 — CID 143880862
8a-(methoxymethyl)-4,4,6a,11,11,14b-hexamethyl-3,13-dioxo-5,6,6a,6b,7,8,9,10,12,12a,14,14a-dodecahydro-4aH-picene-2-carbonitrile;2,2,2-trifluoroacetaldehyde (PubChem CID 143880862) has the molecular formula C33H46F3NO4 and a molecular weight of 577.73 g/mol. Its IUPAC name is 8a-(methoxymethyl)-4,4,6a,11,11,14b-hexamethyl-3,13-dioxo-5,6,6a,6b,7,8,9,10,12,12a,14,14a-dodecahydro-4aH-picene-2-carbonitrile;2,2,2-trifluoroacetaldehyde.
| Compound Name | 8a-(methoxymethyl)-4,4,6a,11,11,14b-hexamethyl-3,13-dioxo-5,6,6a,6b,7,8,9,10,12,12a,14,14a-dodecahydro-4aH-picene-2-carbonitrile;2,2,2-trifluoroacetaldehyde |
|---|---|
| PubChem CID | 143880862 |
| Molecular Formula | C33H46F3NO4 |
| Molecular Weight | 577.73 g/mol |
| Exact Mass | 577.34 |
| IUPAC Name | 8a-(methoxymethyl)-4,4,6a,11,11,14b-hexamethyl-3,13-dioxo-5,6,6a,6b,7,8,9,10,12,12a,14,14a-dodecahydro-4aH-picene-2-carbonitrile;2,2,2-trifluoroacetaldehyde |
| SMILES | COCC12CCC3C(C(=O)CC4C5(C)C=C(C#N)C(=O)C(C)(C)C5CCC34C)C1CC(C)(C)CC2.O=CC(F)(F)F |
| InChI | InChI=1S/C31H45NO3.C2HF3O/c1-27(2)12-13-31(18-35-7)11-8-20-25(21(31)16-27)22(33)14-24-29(20,5)10-9-23-28(3,4)26(34)19(17-32)15-30(23,24)6;3-2(4,5)1-6/h15,20-21,23-25H,8-14,16,18H2,1-7H3;1H |
| InChIKey | NGYIEXGZLPRGHW-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 84.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.73 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|