C31H43NO4 — CID 143880878
2-[(4aR,6aR,6bR,9R,12aR)-11-cyano-2,2,6a,6b,9,12a-hexamethyl-10,14-dioxo-3,4,5,6,6a,7,8,8a,9,13,14a,14b-dodecahydro-1H-picen-4a-yl]acetic acid (PubChem CID 143880878) has the molecular formula C31H43NO4 and a molecular weight of 493.69 g/mol. Its IUPAC name is 2-[(4aR,6aR,6bR,9R,12aR)-11-cyano-2,2,6a,6b,9,12a-hexamethyl-10,14-dioxo-3,4,5,6,6a,7,8,8a,9,13,14a,14b-dodecahydro-1H-picen-4a-yl]acetic acid.
| Compound Name | 2-[(4aR,6aR,6bR,9R,12aR)-11-cyano-2,2,6a,6b,9,12a-hexamethyl-10,14-dioxo-3,4,5,6,6a,7,8,8a,9,13,14a,14b-dodecahydro-1H-picen-4a-yl]acetic acid |
|---|---|
| PubChem CID | 143880878 |
| Molecular Formula | C31H43NO4 |
| Molecular Weight | 493.69 g/mol |
| Exact Mass | 493.32 |
| IUPAC Name | 2-[(4aR,6aR,6bR,9R,12aR)-11-cyano-2,2,6a,6b,9,12a-hexamethyl-10,14-dioxo-3,4,5,6,6a,7,8,8a,9,13,14a,14b-dodecahydro-1H-picen-4a-yl]acetic acid |
| SMILES | C[C@H]1C(=O)C(C#N)=C[C@@]2(C)C1CC[C@]1(C)C2CC(=O)C2C3CC(C)(C)CC[C@]3(CC(=O)O)CC[C@]21C |
| InChI | InChI=1S/C31H43NO4/c1-18-20-7-8-29(5)23(28(20,4)14-19(17-32)26(18)36)13-22(33)25-21-15-27(2,3)9-11-31(21,16-24(34)35)12-10-30(25,29)6/h14,18,20-21,23,25H,7-13,15-16H2,1-6H3,(H,34,35)/t18-,20?,21?,23?,25?,28+,29-,30-,31-/m1/s1 |
| InChIKey | ZQUOVVWSRAYOMK-GSJLYVBRSA-N |
| XLogP | 6.37 |
| TPSA | 95.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.69 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |