C29H43NO3 — CID 143880789
8a-(hydroxymethyl)-4,6a,11,11,14b-pentamethyl-3,13-dioxo-1,2,4,4a,5,6,6a,6b,7,8,9,10,12,12a,14,14a-hexadecahydropicene-2-carbonitrile (PubChem CID 143880789) has the molecular formula C29H43NO3 and a molecular weight of 453.67 g/mol. Its IUPAC name is 8a-(hydroxymethyl)-4,6a,11,11,14b-pentamethyl-3,13-dioxo-1,2,4,4a,5,6,6a,6b,7,8,9,10,12,12a,14,14a-hexadecahydropicene-2-carbonitrile.
| Compound Name | 8a-(hydroxymethyl)-4,6a,11,11,14b-pentamethyl-3,13-dioxo-1,2,4,4a,5,6,6a,6b,7,8,9,10,12,12a,14,14a-hexadecahydropicene-2-carbonitrile |
|---|---|
| PubChem CID | 143880789 |
| Molecular Formula | C29H43NO3 |
| Molecular Weight | 453.67 g/mol |
| Exact Mass | 453.32 |
| IUPAC Name | 8a-(hydroxymethyl)-4,6a,11,11,14b-pentamethyl-3,13-dioxo-1,2,4,4a,5,6,6a,6b,7,8,9,10,12,12a,14,14a-hexadecahydropicene-2-carbonitrile |
| SMILES | CC1C(=O)C(C#N)CC2(C)C1CCC1(C)C3CCC4(CO)CCC(C)(C)CC4C3C(=O)CC21 |
| InChI | InChI=1S/C29H43NO3/c1-17-19-6-8-27(4)20-7-9-29(16-31)11-10-26(2,3)14-21(29)24(20)22(32)12-23(27)28(19,5)13-18(15-30)25(17)33/h17-21,23-24,31H,6-14,16H2,1-5H3 |
| InChIKey | SUYROAZHMVKCBW-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 78.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.67 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyano_keto_A(2)', 'substructure': 'N/A'} |
|---|