C39H55NS — CID 163404040
(E)-3-[1,4a,9,9-tetramethyl-2-(2-methylbut-3-en-2-yl)-11-methylidene-6a-(phenylsulfanylmethyl)-3,4,4b,5,6,7,8,10,10a,10b,12,12a-dodecahydro-2H-chrysen-1-yl]-2-methylprop-2-enenitrile (PubChem CID 163404040) has the molecular formula C39H55NS and a molecular weight of 569.94 g/mol. Its IUPAC name is (E)-3-[1,4a,9,9-tetramethyl-2-(2-methylbut-3-en-2-yl)-11-methylidene-6a-(phenylsulfanylmethyl)-3,4,4b,5,6,7,8,10,10a,10b,12,12a-dodecahydro-2H-chrysen-1-yl]-2-methylprop-2-enenitrile.
| Compound Name | (E)-3-[1,4a,9,9-tetramethyl-2-(2-methylbut-3-en-2-yl)-11-methylidene-6a-(phenylsulfanylmethyl)-3,4,4b,5,6,7,8,10,10a,10b,12,12a-dodecahydro-2H-chrysen-1-yl]-2-methylprop-2-enenitrile |
|---|---|
| PubChem CID | 163404040 |
| Molecular Formula | C39H55NS |
| Molecular Weight | 569.94 g/mol |
| Exact Mass | 569.41 |
| IUPAC Name | (E)-3-[1,4a,9,9-tetramethyl-2-(2-methylbut-3-en-2-yl)-11-methylidene-6a-(phenylsulfanylmethyl)-3,4,4b,5,6,7,8,10,10a,10b,12,12a-dodecahydro-2H-chrysen-1-yl]-2-methylprop-2-enenitrile |
| SMILES | C=CC(C)(C)C1CCC2(C)C3CCC4(CSc5ccccc5)CCC(C)(C)CC4C3C(=C)CC2C1(C)/C=C(\C)C#N |
| InChI | InChI=1S/C39H55NS/c1-10-36(6,7)32-17-18-37(8)30-16-19-39(26-41-29-14-12-11-13-15-29)21-20-35(4,5)24-31(39)34(30)28(3)22-33(37)38(32,9)23-27(2)25-40/h10-15,23,30-34H,1,3,16-22,24,26H2,2,4-9H3/b27-23+ |
| InChIKey | RGSMMEZZGXVZLU-SLEBQGDGSA-N |
| XLogP | 11.30 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.94 |
| LogP ≤ 5 | 11.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|