C19H20O — CID 135015191
(2R)-2-[(1S)-2,2-diphenylcyclopropyl]but-3-en-2-ol (PubChem CID 135015191) has the molecular formula C19H20O and a molecular weight of 264.37 g/mol. Its IUPAC name is (2R)-2-[(1S)-2,2-diphenylcyclopropyl]but-3-en-2-ol.
| Compound Name | (2R)-2-[(1S)-2,2-diphenylcyclopropyl]but-3-en-2-ol |
|---|---|
| PubChem CID | 135015191 |
| Molecular Formula | C19H20O |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | (2R)-2-[(1S)-2,2-diphenylcyclopropyl]but-3-en-2-ol |
| SMILES | C=C[C@@](C)(O)[C@H]1CC1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H20O/c1-3-18(2,20)17-14-19(17,15-10-6-4-7-11-15)16-12-8-5-9-13-16/h3-13,17,20H,1,14H2,2H3/t17-,18-/m1/s1 |
| InChIKey | XPTIMACVGAOVEX-QZTJIDSGSA-N |
| XLogP | 3.93 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|