C23H26O2 — CID 102275177
3-[2-(2,2-diphenylcyclopropyl)cyclopropyl]-3-hydroxy-2,2-dimethylpropanal (PubChem CID 102275177) has the molecular formula C23H26O2 and a molecular weight of 334.46 g/mol. Its IUPAC name is 3-[2-(2,2-diphenylcyclopropyl)cyclopropyl]-3-hydroxy-2,2-dimethylpropanal.
| Compound Name | 3-[2-(2,2-diphenylcyclopropyl)cyclopropyl]-3-hydroxy-2,2-dimethylpropanal |
|---|---|
| PubChem CID | 102275177 |
| Molecular Formula | C23H26O2 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | 3-[2-(2,2-diphenylcyclopropyl)cyclopropyl]-3-hydroxy-2,2-dimethylpropanal |
| SMILES | CC(C)(C=O)C(O)C1CC1C1CC1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H26O2/c1-22(2,15-24)21(25)19-13-18(19)20-14-23(20,16-9-5-3-6-10-16)17-11-7-4-8-12-17/h3-12,15,18-21,25H,13-14H2,1-2H3 |
| InChIKey | MEVWVVGOWKITJL-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|