C21H27NO2 — CID 10663839
(1R,2S,5S)-5-(tert-butylamino)-3,3-diphenylcyclopentane-1,2-diol (PubChem CID 10663839) has the molecular formula C21H27NO2 and a molecular weight of 325.45 g/mol. Its IUPAC name is (1R,2S,5S)-5-(tert-butylamino)-3,3-diphenylcyclopentane-1,2-diol.
| Compound Name | (1R,2S,5S)-5-(tert-butylamino)-3,3-diphenylcyclopentane-1,2-diol |
|---|---|
| PubChem CID | 10663839 |
| Molecular Formula | C21H27NO2 |
| Molecular Weight | 325.45 g/mol |
| Exact Mass | 325.20 |
| IUPAC Name | (1R,2S,5S)-5-(tert-butylamino)-3,3-diphenylcyclopentane-1,2-diol |
| SMILES | CC(C)(C)N[C@H]1CC(c2ccccc2)(c2ccccc2)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C21H27NO2/c1-20(2,3)22-17-14-21(19(24)18(17)23,15-10-6-4-7-11-15)16-12-8-5-9-13-16/h4-13,17-19,22-24H,14H2,1-3H3/t17-,18+,19+/m0/s1 |
| InChIKey | RWPMUIJFRKMCAN-IPMKNSEASA-N |
| XLogP | 2.85 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.45 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |