C22H27NO — CID 10591883
N-tert-butyl-4-(4-methoxyphenyl)-4-phenylcyclopent-2-en-1-amine (PubChem CID 10591883) has the molecular formula C22H27NO and a molecular weight of 321.46 g/mol. Its IUPAC name is N-tert-butyl-4-(4-methoxyphenyl)-4-phenylcyclopent-2-en-1-amine.
| Compound Name | N-tert-butyl-4-(4-methoxyphenyl)-4-phenylcyclopent-2-en-1-amine |
|---|---|
| PubChem CID | 10591883 |
| Molecular Formula | C22H27NO |
| Molecular Weight | 321.46 g/mol |
| Exact Mass | 321.21 |
| IUPAC Name | N-tert-butyl-4-(4-methoxyphenyl)-4-phenylcyclopent-2-en-1-amine |
| SMILES | COc1ccc(C2(c3ccccc3)C=CC(NC(C)(C)C)C2)cc1 |
| InChI | InChI=1S/C22H27NO/c1-21(2,3)23-19-14-15-22(16-19,17-8-6-5-7-9-17)18-10-12-20(24-4)13-11-18/h5-15,19,23H,16H2,1-4H3 |
| InChIKey | VKBGANCGYZMWLJ-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.46 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|