C21H28ClNO2 — CID 67744270
(2R)-5-(tert-butylamino)-3,3-diphenylcyclopentane-1,2-diol;hydrochloride (PubChem CID 67744270) has the molecular formula C21H28ClNO2 and a molecular weight of 361.91 g/mol. Its IUPAC name is (2R)-5-(tert-butylamino)-3,3-diphenylcyclopentane-1,2-diol;hydrochloride.
| Compound Name | (2R)-5-(tert-butylamino)-3,3-diphenylcyclopentane-1,2-diol;hydrochloride |
|---|---|
| PubChem CID | 67744270 |
| Molecular Formula | C21H28ClNO2 |
| Molecular Weight | 361.91 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | (2R)-5-(tert-butylamino)-3,3-diphenylcyclopentane-1,2-diol;hydrochloride |
| SMILES | CC(C)(C)NC1CC(c2ccccc2)(c2ccccc2)[C@@H](O)C1O.Cl |
| InChI | InChI=1S/C21H27NO2.ClH/c1-20(2,3)22-17-14-21(19(24)18(17)23,15-10-6-4-7-11-15)16-12-8-5-9-13-16;/h4-13,17-19,22-24H,14H2,1-3H3;1H/t17?,18?,19-;/m0./s1 |
| InChIKey | JMTGWJQRFVRGFJ-POAWQLQASA-N |
| XLogP | 3.28 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.91 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |