C17H24O — CID 101481137
cis-(1S,3S)-1-(2-methylbut-3-en-2-yl)-3-phenylcyclohexan-1-ol (PubChem CID 101481137) has the molecular formula C17H24O and a molecular weight of 244.38 g/mol. Its IUPAC name is cis-(1S,3S)-1-(2-methylbut-3-en-2-yl)-3-phenylcyclohexan-1-ol.
| Compound Name | cis-(1S,3S)-1-(2-methylbut-3-en-2-yl)-3-phenylcyclohexan-1-ol |
|---|---|
| PubChem CID | 101481137 |
| Molecular Formula | C17H24O |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | cis-(1S,3S)-1-(2-methylbut-3-en-2-yl)-3-phenylcyclohexan-1-ol |
| SMILES | C=CC(C)(C)[C@]1(O)CCC[C@H](c2ccccc2)C1 |
| InChI | InChI=1S/C17H24O/c1-4-16(2,3)17(18)12-8-11-15(13-17)14-9-6-5-7-10-14/h4-7,9-10,15,18H,1,8,11-13H2,2-3H3/t15-,17-/m0/s1 |
| InChIKey | KUDFUGYOPLWIJO-RDJZCZTQSA-N |
| XLogP | 4.29 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|