C16H22O — CID 102289513
cis-(1R,2S)-1-[(2R)-but-3-en-2-yl]-2-phenylcyclohexan-1-ol (PubChem CID 102289513) has the molecular formula C16H22O and a molecular weight of 230.35 g/mol. Its IUPAC name is cis-(1R,2S)-1-[(2R)-but-3-en-2-yl]-2-phenylcyclohexan-1-ol.
| Compound Name | cis-(1R,2S)-1-[(2R)-but-3-en-2-yl]-2-phenylcyclohexan-1-ol |
|---|---|
| PubChem CID | 102289513 |
| Molecular Formula | C16H22O |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.17 |
| IUPAC Name | cis-(1R,2S)-1-[(2R)-but-3-en-2-yl]-2-phenylcyclohexan-1-ol |
| SMILES | C=C[C@@H](C)[C@]1(O)CCCC[C@H]1c1ccccc1 |
| InChI | InChI=1S/C16H22O/c1-3-13(2)16(17)12-8-7-11-15(16)14-9-5-4-6-10-14/h3-6,9-10,13,15,17H,1,7-8,11-12H2,2H3/t13-,15+,16-/m1/s1 |
| InChIKey | TUZMRNWSRPTJDX-VNQPRFMTSA-N |
| XLogP | 3.90 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|