C12H16O4S — CID 103574511
1-hydroxy-2-phenylcyclohexane-1-sulfonic acid (PubChem CID 103574511) has the molecular formula C12H16O4S and a molecular weight of 256.32 g/mol. Its IUPAC name is 1-hydroxy-2-phenylcyclohexane-1-sulfonic acid.
| Compound Name | 1-hydroxy-2-phenylcyclohexane-1-sulfonic acid |
|---|---|
| PubChem CID | 103574511 |
| Molecular Formula | C12H16O4S |
| Molecular Weight | 256.32 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | 1-hydroxy-2-phenylcyclohexane-1-sulfonic acid |
| SMILES | O=S(=O)(O)C1(O)CCCCC1c1ccccc1 |
| InChI | InChI=1S/C12H16O4S/c13-12(17(14,15)16)9-5-4-8-11(12)10-6-2-1-3-7-10/h1-3,6-7,11,13H,4-5,8-9H2,(H,14,15,16) |
| InChIKey | XREVVMVWLGHZDE-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.32 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|