C18H21O3P — CID 54360271
(1,2-diphenylcyclohexyl) dihydrogen phosphite (PubChem CID 54360271) has the molecular formula C18H21O3P and a molecular weight of 316.34 g/mol. Its IUPAC name is (1,2-diphenylcyclohexyl) dihydrogen phosphite.
| Compound Name | (1,2-diphenylcyclohexyl) dihydrogen phosphite |
|---|---|
| PubChem CID | 54360271 |
| Molecular Formula | C18H21O3P |
| Molecular Weight | 316.34 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | (1,2-diphenylcyclohexyl) dihydrogen phosphite |
| SMILES | OP(O)OC1(c2ccccc2)CCCCC1c1ccccc1 |
| InChI | InChI=1S/C18H21O3P/c19-22(20)21-18(16-11-5-2-6-12-16)14-8-7-13-17(18)15-9-3-1-4-10-15/h1-6,9-12,17,19-20H,7-8,13-14H2 |
| InChIKey | UMAJGVCPBJMMPW-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.34 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|