C15H21N — CID 97356341
(5S,6S)-6-phenyl-1-azaspiro[4.5]decane (PubChem CID 97356341) has the molecular formula C15H21N and a molecular weight of 215.34 g/mol. Its IUPAC name is (5S,6S)-6-phenyl-1-azaspiro[4.5]decane.
| Compound Name | (5S,6S)-6-phenyl-1-azaspiro[4.5]decane |
|---|---|
| PubChem CID | 97356341 |
| Molecular Formula | C15H21N |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.17 |
| IUPAC Name | (5S,6S)-6-phenyl-1-azaspiro[4.5]decane |
| SMILES | c1ccc([C@@H]2CCCC[C@]23CCCN3)cc1 |
| InChI | InChI=1S/C15H21N/c1-2-7-13(8-3-1)14-9-4-5-10-15(14)11-6-12-16-15/h1-3,7-8,14,16H,4-6,9-12H2/t14-,15-/m0/s1 |
| InChIKey | UOVPTGPDKNPQRJ-GJZGRUSLSA-N |
| XLogP | 3.47 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |