C21H25N — CID 139931601
4,6-diphenyl-7-azaspiro[4.5]decane (PubChem CID 139931601) has the molecular formula C21H25N and a molecular weight of 291.44 g/mol. Its IUPAC name is 4,6-diphenyl-7-azaspiro[4.5]decane.
| Compound Name | 4,6-diphenyl-7-azaspiro[4.5]decane |
|---|---|
| PubChem CID | 139931601 |
| Molecular Formula | C21H25N |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.20 |
| IUPAC Name | 4,6-diphenyl-7-azaspiro[4.5]decane |
| SMILES | c1ccc(C2CCCC23CCCNC3c2ccccc2)cc1 |
| InChI | InChI=1S/C21H25N/c1-3-9-17(10-4-1)19-13-7-14-21(19)15-8-16-22-20(21)18-11-5-2-6-12-18/h1-6,9-12,19-20,22H,7-8,13-16H2 |
| InChIKey | LSSMEKTYQARRHA-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |