C14H20N2 — CID 91595107
6-phenyl-1,9-diazaspiro[4.5]decane (PubChem CID 91595107) has the molecular formula C14H20N2 and a molecular weight of 216.33 g/mol. Its IUPAC name is 6-phenyl-1,9-diazaspiro[4.5]decane.
| Compound Name | 6-phenyl-1,9-diazaspiro[4.5]decane |
|---|---|
| PubChem CID | 91595107 |
| Molecular Formula | C14H20N2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | 6-phenyl-1,9-diazaspiro[4.5]decane |
| SMILES | c1ccc(C2CCNCC23CCCN3)cc1 |
| InChI | InChI=1S/C14H20N2/c1-2-5-12(6-3-1)13-7-10-15-11-14(13)8-4-9-16-14/h1-3,5-6,13,15-16H,4,7-11H2 |
| InChIKey | WLYBFRPAHVGJCG-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |