C12H15N — CID 121315230
(2R,3S)-2-phenyl-5-azaspiro[2.4]heptane (PubChem CID 121315230) has the molecular formula C12H15N and a molecular weight of 173.26 g/mol. Its IUPAC name is (2R,3S)-2-phenyl-5-azaspiro[2.4]heptane.
| Compound Name | (2R,3S)-2-phenyl-5-azaspiro[2.4]heptane |
|---|---|
| PubChem CID | 121315230 |
| Molecular Formula | C12H15N |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | (2R,3S)-2-phenyl-5-azaspiro[2.4]heptane |
| SMILES | c1ccc([C@H]2C[C@]23CCNC3)cc1 |
| InChI | InChI=1S/C12H15N/c1-2-4-10(5-3-1)11-8-12(11)6-7-13-9-12/h1-5,11,13H,6-9H2/t11-,12+/m1/s1 |
| InChIKey | XZYJXQOXVPUKMX-NEPJUHHUSA-N |
| XLogP | 2.15 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |