trans-(1R,2S)-1-amino-2-phenylcycloheptane-1-carboxylic acid

C14H19NO2 — CID 34176616

IUPACtrans-(1R,2S)-1-amino-2-phenylcycloheptane-1-carboxylic acid
SMILESN[C@]1(C(=O)O)CCCCC[C@H]1c1ccccc1
InChIInChI=1S/C14H19NO2/c15-14(13(16)17)10-6-2-5-9-12(14)11-7-3-1-4-8-11/h1,3-4,7-8,12H,2,5-6,9-10,15H2,(H,16,17)/t12-,14+/m0/s1
InChIKeyHOMJXBBZJQKYIN-GXTWGEPZSA-N
MW233.31 g/mol
LogP2.52
Rot. Bonds2

About trans-(1R,2S)-1-amino-2-phenylcycloheptane-1-carboxylic acid

trans-(1R,2S)-1-amino-2-phenylcycloheptane-1-carboxylic acid (PubChem CID 34176616) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is trans-(1R,2S)-1-amino-2-phenylcycloheptane-1-carboxylic acid.

Molecular Properties

Compound Nametrans-(1R,2S)-1-amino-2-phenylcycloheptane-1-carboxylic acid
PubChem CID34176616
Molecular FormulaC14H19NO2
Molecular Weight233.31 g/mol
Exact Mass233.14
IUPAC Nametrans-(1R,2S)-1-amino-2-phenylcycloheptane-1-carboxylic acid
SMILESN[C@]1(C(=O)O)CCCCC[C@H]1c1ccccc1
InChIInChI=1S/C14H19NO2/c15-14(13(16)17)10-6-2-5-9-12(14)11-7-3-1-4-8-11/h1,3-4,7-8,12H,2,5-6,9-10,15H2,(H,16,17)/t12-,14+/m0/s1
InChIKeyHOMJXBBZJQKYIN-GXTWGEPZSA-N
XLogP2.52
TPSA63.32 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500233.31
LogP ≤ 52.52
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze trans-(1R,2S)-1-amino-2-phenylcycloheptane-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of trans-(1R,2S)-1-amino-2-phenylcycloheptane-1-carboxylic acid?
The IUPAC name of trans-(1R,2S)-1-amino-2-phenylcycloheptane-1-carboxylic acid (CID 34176616) is trans-(1R,2S)-1-amino-2-phenylcycloheptane-1-carboxylic acid.
What is the SMILES notation for trans-(1R,2S)-1-amino-2-phenylcycloheptane-1-carboxylic acid?
The canonical SMILES for trans-(1R,2S)-1-amino-2-phenylcycloheptane-1-carboxylic acid is N[C@]1(C(=O)O)CCCCC[C@H]1c1ccccc1.
What is the InChIKey of trans-(1R,2S)-1-amino-2-phenylcycloheptane-1-carboxylic acid?
The InChIKey is HOMJXBBZJQKYIN-GXTWGEPZSA-N. The full InChI is InChI=1S/C14H19NO2/c15-14(13(16)17)10-6-2-5-9-12(14)11-7-3-1-4-8-11/h1,3-4,7-8,12H,2,5-6,9-10,15H2,(H,16,17)/t12-,14+/m0/s1.
What are the key properties of trans-(1R,2S)-1-amino-2-phenylcycloheptane-1-carboxylic acid?
trans-(1R,2S)-1-amino-2-phenylcycloheptane-1-carboxylic acid has a molecular weight of 233.31 g/mol, XLogP of 2.52, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1R,2S)-1-amino-2-phenylcycloheptane-1-carboxylic acid is sourced from PubChem (CID 34176616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).