C15H18F3NO2 — CID 105401946
2-phenyl-1-(2,2,2-trifluoroethylamino)cyclohexane-1-carboxylic acid (PubChem CID 105401946) has the molecular formula C15H18F3NO2 and a molecular weight of 301.31 g/mol. Its IUPAC name is 2-phenyl-1-(2,2,2-trifluoroethylamino)cyclohexane-1-carboxylic acid.
| Compound Name | 2-phenyl-1-(2,2,2-trifluoroethylamino)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 105401946 |
| Molecular Formula | C15H18F3NO2 |
| Molecular Weight | 301.31 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | 2-phenyl-1-(2,2,2-trifluoroethylamino)cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1(NCC(F)(F)F)CCCCC1c1ccccc1 |
| InChI | InChI=1S/C15H18F3NO2/c16-15(17,18)10-19-14(13(20)21)9-5-4-8-12(14)11-6-2-1-3-7-11/h1-3,6-7,12,19H,4-5,8-10H2,(H,20,21) |
| InChIKey | UZZIZCUKAXZAQA-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.31 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |