C11H13NO2 — CID 155893335
(1S)-1-amino-2-phenylcyclobutane-1-carboxylic acid (PubChem CID 155893335) has the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. Its IUPAC name is (1S)-1-amino-2-phenylcyclobutane-1-carboxylic acid.
| Compound Name | (1S)-1-amino-2-phenylcyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 155893335 |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | (1S)-1-amino-2-phenylcyclobutane-1-carboxylic acid |
| SMILES | N[C@@]1(C(=O)O)CCC1c1ccccc1 |
| InChI | InChI=1S/C11H13NO2/c12-11(10(13)14)7-6-9(11)8-4-2-1-3-5-8/h1-5,9H,6-7,12H2,(H,13,14)/t9?,11-/m0/s1 |
| InChIKey | HOQAZBBALROTIH-UMJHXOGRSA-N |
| XLogP | 1.35 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |