C17H26O — CID 65147898
1-(2-methylbutyl)-2-phenylcyclohexan-1-ol (PubChem CID 65147898) has the molecular formula C17H26O and a molecular weight of 246.39 g/mol. Its IUPAC name is 1-(2-methylbutyl)-2-phenylcyclohexan-1-ol.
| Compound Name | 1-(2-methylbutyl)-2-phenylcyclohexan-1-ol |
|---|---|
| PubChem CID | 65147898 |
| Molecular Formula | C17H26O |
| Molecular Weight | 246.39 g/mol |
| Exact Mass | 246.20 |
| IUPAC Name | 1-(2-methylbutyl)-2-phenylcyclohexan-1-ol |
| SMILES | CCC(C)CC1(O)CCCCC1c1ccccc1 |
| InChI | InChI=1S/C17H26O/c1-3-14(2)13-17(18)12-8-7-11-16(17)15-9-5-4-6-10-15/h4-6,9-10,14,16,18H,3,7-8,11-13H2,1-2H3 |
| InChIKey | CNBAJRUZILXHJF-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.39 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |