C19H21ClO — CID 60798196
1-[(2-chlorophenyl)methyl]-2-phenylcyclohexan-1-ol (PubChem CID 60798196) has the molecular formula C19H21ClO and a molecular weight of 300.83 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)methyl]-2-phenylcyclohexan-1-ol.
| Compound Name | 1-[(2-chlorophenyl)methyl]-2-phenylcyclohexan-1-ol |
|---|---|
| PubChem CID | 60798196 |
| Molecular Formula | C19H21ClO |
| Molecular Weight | 300.83 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 1-[(2-chlorophenyl)methyl]-2-phenylcyclohexan-1-ol |
| SMILES | OC1(Cc2ccccc2Cl)CCCCC1c1ccccc1 |
| InChI | InChI=1S/C19H21ClO/c20-18-12-5-4-10-16(18)14-19(21)13-7-6-11-17(19)15-8-2-1-3-9-15/h1-5,8-10,12,17,21H,6-7,11,13-14H2 |
| InChIKey | GTJTTZHVTGXNSH-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.83 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |