C18H20BrNO — CID 104801472
1-[(5-bromo-3-pyridinyl)methyl]-2-phenylcyclohexan-1-ol (PubChem CID 104801472) has the molecular formula C18H20BrNO and a molecular weight of 346.27 g/mol. Its IUPAC name is 1-[(5-bromo-3-pyridinyl)methyl]-2-phenylcyclohexan-1-ol.
| Compound Name | 1-[(5-bromo-3-pyridinyl)methyl]-2-phenylcyclohexan-1-ol |
|---|---|
| PubChem CID | 104801472 |
| Molecular Formula | C18H20BrNO |
| Molecular Weight | 346.27 g/mol |
| Exact Mass | 345.07 |
| IUPAC Name | 1-[(5-bromo-3-pyridinyl)methyl]-2-phenylcyclohexan-1-ol |
| SMILES | OC1(Cc2cncc(Br)c2)CCCCC1c1ccccc1 |
| InChI | InChI=1S/C18H20BrNO/c19-16-10-14(12-20-13-16)11-18(21)9-5-4-8-17(18)15-6-2-1-3-7-15/h1-3,6-7,10,12-13,17,21H,4-5,8-9,11H2 |
| InChIKey | OMUWHJUNVJFJOT-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.27 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |