C20H24O — CID 60797806
1-[(3-methylphenyl)methyl]-2-phenylcyclohexan-1-ol (PubChem CID 60797806) has the molecular formula C20H24O and a molecular weight of 280.41 g/mol. Its IUPAC name is 1-[(3-methylphenyl)methyl]-2-phenylcyclohexan-1-ol.
| Compound Name | 1-[(3-methylphenyl)methyl]-2-phenylcyclohexan-1-ol |
|---|---|
| PubChem CID | 60797806 |
| Molecular Formula | C20H24O |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | 1-[(3-methylphenyl)methyl]-2-phenylcyclohexan-1-ol |
| SMILES | Cc1cccc(CC2(O)CCCCC2c2ccccc2)c1 |
| InChI | InChI=1S/C20H24O/c1-16-8-7-9-17(14-16)15-20(21)13-6-5-12-19(20)18-10-3-2-4-11-18/h2-4,7-11,14,19,21H,5-6,12-13,15H2,1H3 |
| InChIKey | QSEPUTYUWPPZGO-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |